CAS 84145-73-3
:2,6-Dimethyl-4-morpholinepropanenitrile
Description:
2,6-Dimethyl-4-morpholinepropanenitrile, with the CAS number 84145-73-3, is a chemical compound characterized by its unique structure, which includes a morpholine ring and a nitrile functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its moderate polarity, which allows it to dissolve in various organic solvents while being less soluble in water. The presence of the nitrile group contributes to its reactivity, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, the dimethyl substitution on the aromatic ring can influence its physical properties, such as boiling point and melting point, as well as its chemical reactivity. Safety data indicates that, like many nitriles, it should be handled with care due to potential toxicity and irritant properties. Proper storage and handling protocols are essential to ensure safety when working with this compound.
Formula:C9H16N2O
InChI:InChI=1S/C9H16N2O/c1-8-6-11(5-3-4-10)7-9(2)12-8/h8-9H,3,5-7H2,1-2H3
InChI key:InChIKey=BEJUPEKPJOPODY-UHFFFAOYSA-N
SMILES:C(CC#N)N1CC(C)OC(C)C1
Synonyms:- 2,6-Dimethyl-4-morpholinepropanenitrile
- 2,6-Dimethyl-4-morpholinepropiononitrile
- 3-(2,6-Dimethylmorpholin-4-Yl)Propanenitrile
- 4-Morpholinepropanenitrile, 2,6-dimethyl-
- NSC 163169
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.