CymitQuimica logo

CAS 84145-77-7

:

Boron, (1,2-dimethyl-1H-imidazole-N3)trifluoro-, (T-4)-

Description:
Boron, (1,2-dimethyl-1H-imidazole-N3)trifluoro-, commonly referred to by its CAS number 84145-77-7, is a chemical compound that features a boron atom coordinated to a 1,2-dimethyl-1H-imidazole moiety and trifluoro groups. This compound exhibits characteristics typical of organoboron compounds, including potential applications in medicinal chemistry and materials science due to its unique electronic properties. The presence of the trifluoro group enhances its stability and solubility in organic solvents, while the imidazole ring contributes to its biological activity, potentially influencing interactions with biological targets. The compound may also exhibit interesting photophysical properties, making it a candidate for use in fluorescence applications. Additionally, the structural features of this compound suggest it could participate in various chemical reactions, including coordination with metals or other ligands, which could be explored for catalytic applications. Overall, this compound represents a fascinating intersection of boron chemistry and heterocyclic organic chemistry.
Formula:C5H8BF3N2
InChI:InChI=1S/C5H8BF3N2/c1-5-10(2)3-4-11(5)6(7,8)9/h3-4H,1-2H3
InChI key:InChIKey=UGRUHNOULVHNPY-UHFFFAOYSA-N
SMILES:[B+3]([F-])([F-])([F-])[N]1=C(C)N(C)C=C1
Synonyms:
  • 1H-Imidazole, 1,2-dimethyl-, boron complex
  • Boron, (1,2-dimethyl-1H-imidazole-N3)trifluoro-, (T-4)-
  • (1,2-Dimethyl-1H-imidazole-N3)trifluoroboron
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.