CAS 84162-80-1

4-(2,4-Difluorobenzoyl)-1-piperidine carboxaldehyde

Description:

4-(2,4-Difluorobenzoyl)-1-piperidine carboxaldehyde is an organic compound characterized by its unique structure, which includes a piperidine ring and a benzoyl group substituted with two fluorine atoms. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It features a carboxaldehyde functional group, which is known for its reactivity, particularly in condensation reactions and as a precursor in various synthetic pathways. The presence of fluorine atoms enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. Its synthesis and handling require standard laboratory safety protocols due to the reactive nature of the aldehyde group and the potential hazards associated with fluorinated compounds. Overall, 4-(2,4-Difluorobenzoyl)-1-piperidine carboxaldehyde is a compound of interest for further research and application in various chemical fields.

Formula: C₁₃H₁₃F₂NO₂

InChI: InChI=1S/C13H13F2NO2/c14-10-1-2-11(12(15)7-10)13(18)9-3-5-16(8-17)6-4-9/h1-2,7-9H,3-6H2

InChI key: InChIKey=YTHQJLIGWJTKPG-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(F)C=C1)C2CCN(C=O)CC2

Synonyms:

• 4-(2,4-Difluorobenzoyl)-1-piperidinecarboxaldehyde
• 4-(2,4-Difluorobenzoyl)-1-piperidine carboxaldehyde
• 1-Piperidinecarboxaldehyde, 4-(2,4-difluorobenzoyl)-
• 4-(2,4-DIFLUORO-BENZOYL)-PIPERIDINE-1-CARBALDEHYDE
• 1-Formyl-4-(2,4-difluorobenzoyl)piperidine

Risperidone Impurity 3

CAS: 84162-80-1

Formula: C₁₃H₁₃F₂NO₂

Molecular weight: 253.2

Ref: ST-EA-CP-R15039