CAS 84162-86-7

2,4-Difluorophenyl-4-piperidyl ketone

Description:

2,4-Difluorophenyl-4-piperidyl ketone, with the CAS number 84162-86-7, is a chemical compound characterized by its unique structure, which includes a difluorophenyl group and a piperidyl moiety linked through a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of fluorine atoms can enhance lipophilicity and influence the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the piperidine ring may impart certain pharmacological properties, potentially affecting its binding affinity and selectivity for various receptors or enzymes. As with many ketones, it may participate in nucleophilic addition reactions, and its stability can be influenced by environmental factors such as temperature and pH. Overall, 2,4-Difluorophenyl-4-piperidyl ketone represents a compound of interest for further research, particularly in the fields of drug development and synthetic chemistry.

Formula: C₁₂H₁₃F₂NO

InChI: InChI=1/C12H13F2NO/c13-9-1-2-10(11(14)7-9)12(16)8-3-5-15-6-4-8/h1-2,7-8,15H,3-6H2

SMILES: c1cc(c(cc1F)F)C(=O)C1CCNCC1

Synonyms:

• (2,4-Difluorophenyl)(piperidin-4-yl)methanone
• Methanone, (2,4-Difluorophenyl)-4-Piperidinyl-
• 1-(2',4'-Difluorophenyl)-1-(4-Piperidinyl) Methanone

(2,4-Difluorophenyl)(piperidin-4-yl)methanone

CAS: 84162-86-7

Formula: C₁₂H₁₃F₂NO

Molecular weight: 225.2345

Ref: IN-DA00IDCL

4-(2,4-Difluorobenzoyl)piperidine

CAS: 84162-86-7

4-(2,4-Difluorobenzoyl)piperidine

Molecular weight: 225.23453g/mol

Ref: 54-PC107398

1-(2',4'-Difluorophenyl)-1-(4-piperidinyl) methanone

CAS: 84162-86-7

Risperidone is an antipsychotic drug that is used to treat schizophrenia and other mental disorders. It is a benzisoxazole derivative that has been shown to be an antagonist at dopamine D2, serotonin 5-HT1A, and histamine H1 receptors. Risperidone also has oxime properties. The cyclization of the molecule produces a 4-piperidinol moiety. This can then undergo oxidation by acetonitrile or methyl isobutyl ketone to produce the corresponding methyl isobutyl ketones. These ketones are metabolized in animals by monoamine oxidase (MAO) and cytochrome P450 enzymes such as CYP2D6 and CYP3A4. In humans, risperidone undergoes hydroxylation by CYP3A4, leading to the formation of 4-hydroxyrisperidone, which may contribute to its therapeutic effects.

Formula: C₁₂H₁₃NOF₂

Purity: Min. 95%

Molecular weight: 225.23 g/mol

Ref: 3D-FD93016