CAS 84163-47-3
:1-Piperidinecarboxylic acid, 4-[(hydroxyimino)(2-hydroxy-4-methoxyphenyl)methyl]-, phenylmethyl ester, (E)-
Description:
1-Piperidinecarboxylic acid, 4-[(hydroxyimino)(2-hydroxy-4-methoxyphenyl)methyl]-, phenylmethyl ester, (E)- is a complex organic compound characterized by its piperidine ring structure, which contributes to its basicity and potential for forming hydrogen bonds. The presence of a hydroxyimino group indicates that it can participate in various chemical reactions, such as condensation and nucleophilic attacks. The compound also features a methoxy group, which can enhance its lipophilicity and influence its biological activity. The phenylmethyl ester moiety suggests that it may exhibit ester-like properties, potentially affecting its solubility and reactivity. This compound is likely to be of interest in medicinal chemistry due to its structural features, which may confer specific pharmacological properties. Its stereochemistry, indicated by the (E)- configuration, suggests a particular spatial arrangement that could be crucial for its interaction with biological targets. Overall, this compound's unique combination of functional groups and structural elements makes it a candidate for further investigation in various chemical and pharmaceutical applications.
Formula:C21H24N2O5
InChI:InChI=1S/C21H24N2O5/c1-27-17-7-8-18(19(24)13-17)20(22-26)16-9-11-23(12-10-16)21(25)28-14-15-5-3-2-4-6-15/h2-8,13,16,24,26H,9-12,14H2,1H3/b22-20+
InChI key:InChIKey=OMXRTLYHQCREKX-LSDHQDQOSA-N
SMILES:C(=N\O)(\C1CCN(C(OCC2=CC=CC=C2)=O)CC1)/C3=C(O)C=C(OC)C=C3
Synonyms:- 1-Piperidinecarboxylic acid, 4-[(hydroxyimino)(2-hydroxy-4-methoxyphenyl)methyl]-, phenylmethyl ester, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(E)-2-(5-Methoxy)phenol 4-(N-Benzyloxycarbonyl)piperidinyl-methanone Oxime
CAS:Controlled ProductFormula:C21H24N2O5Color and Shape:NeatMolecular weight:384.43
