CymitQuimica logo

CAS 84163-64-4

:

1,2-Benzisoxazol-5-Fluoro-3-(4-Piperidinyl)

Description:
1,2-Benzisoxazol-5-fluoro-3-(4-piperidinyl) is a chemical compound characterized by its unique structure, which includes a benzisoxazole moiety and a piperidine ring. The presence of a fluorine atom at the 5-position of the benzisoxazole contributes to its chemical reactivity and potential biological activity. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate to high lipophilicity, which can influence its pharmacokinetics and bioavailability. The piperidine group is known for its ability to interact with various biological targets, making this compound of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific applications may include roles in neuropharmacology or as a potential therapeutic agent, although detailed studies would be necessary to elucidate its full biological profile. As with many synthetic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity associated with its functional groups.
Formula:C12H13FN2O
InChI:InChI=1/C12H13FN2O/c13-9-1-2-11-10(7-9)12(15-16-11)8-3-5-14-6-4-8/h1-2,7-8,14H,3-6H2
SMILES:c1cc2c(cc1F)c(C1CCNCC1)no2
Synonyms:
  • 5-Fluoro-3-Piperidin-4-Yl-1,2-Benzisoxazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.