CAS 84163-79-1
:8-(Bromomethyl)-7-chloroquinoline
Description:
8-(Bromomethyl)-7-chloroquinoline is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a bromomethyl group at the 8-position and a chlorine atom at the 7-position of the quinoline ring, contributing to its reactivity and potential applications in medicinal chemistry. The presence of halogen substituents often enhances the compound's biological activity and can influence its pharmacokinetic properties. Typically, compounds like this may exhibit antimicrobial, antiviral, or anticancer properties, making them of interest in drug development. The molecular weight and specific physical properties, such as solubility and melting point, can vary based on the substituents and the overall structure. Additionally, safety and handling precautions are essential due to the presence of halogens, which can pose health risks. As with any chemical, proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is crucial for confirming its identity and purity in research and industrial applications.
Formula:C10H7BrClN
InChI:InChI=1S/C10H7BrClN/c11-6-8-9(12)4-3-7-2-1-5-13-10(7)8/h1-5H,6H2
InChI key:InChIKey=SLSLEAFNODKCFA-UHFFFAOYSA-N
SMILES:C(Br)C=1C2=C(C=CC1Cl)C=CC=N2
Synonyms:- 8-(Bromomethyl)-7-chloroquinoline
- Quinoline, 8-(bromomethyl)-7-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.