CymitQuimica logo

CAS 84165-42-4

:

8-(benzyloxy)quinoline

Description:
8-(Benzyloxy)quinoline is an organic compound characterized by its quinoline backbone, which is a bicyclic structure consisting of a benzene ring fused to a pyridine ring. The presence of a benzyloxy group at the 8-position enhances its solubility and reactivity, making it useful in various chemical applications. This compound typically exhibits properties such as moderate to high melting and boiling points, depending on its purity and specific structural characteristics. It is often utilized in organic synthesis, particularly in the development of fluorescent probes and as a ligand in coordination chemistry due to its ability to coordinate with metal ions. Additionally, 8-(benzyloxy)quinoline may exhibit biological activity, making it of interest in medicinal chemistry. Its chemical behavior can be influenced by factors such as pH and solvent polarity, which can affect its protonation state and overall reactivity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C16H13NO
InChI:InChI=1/C16H13NO/c1-2-6-13(7-3-1)12-18-15-10-4-8-14-9-5-11-17-16(14)15/h1-11H,12H2
Synonyms:
  • 8-(Benzyloxy)quinoline
  • quinoline, 8-(phenylmethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.