CAS 84174-21-0
:1-(4-fluorophenyl)-N-methyl-N-nitrosomethanamine
Description:
1-(4-Fluorophenyl)-N-methyl-N-nitrosomethanamine, with the CAS number 84174-21-0, is a chemical compound that belongs to the class of nitrosamines, which are known for their potential carcinogenic properties. This compound features a nitrosamine functional group, characterized by the presence of a nitroso group (–N=O) attached to a secondary amine. The presence of the 4-fluorophenyl group indicates that it has a fluorine atom substituted on a phenyl ring, which can influence its chemical reactivity and biological activity. The methyl group attached to the nitrogen contributes to its overall structure and may affect its solubility and interaction with biological systems. Due to its nitrosamine nature, this compound may pose health risks, particularly in terms of carcinogenicity, and is subject to regulatory scrutiny. Handling and usage of such substances require caution, and they are typically studied in the context of toxicology and environmental chemistry.
Formula:C8H9FN2O
InChI:InChI=1/C8H9FN2O/c1-11(10-12)6-7-2-4-8(9)5-3-7/h2-5H,6H2,1H3
SMILES:CN(Cc1ccc(cc1)F)N=O
Synonyms:- benzenemethanamine, 4-fluoro-N-methyl-N-nitroso-
- 1-(4-Fluorophenyl)-N-methyl-N-nitrosomethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.