CAS 84175-05-3
:2-(4-nitropyridin-2-yl)pyridine 1-oxide
Description:
2-(4-Nitropyridin-2-yl)pyridine 1-oxide, with the CAS number 84175-05-3, is a heterocyclic organic compound characterized by the presence of both pyridine and nitro functional groups. This compound features a pyridine ring substituted at the 2-position with a pyridine 1-oxide moiety and at the 4-position with a nitro group. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and interactions with other chemical species. The 1-oxide functionality indicates that one of the nitrogen atoms in the pyridine ring is oxidized, which can affect the compound's basicity and overall stability. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and material science. Additionally, the structural features suggest potential applications in coordination chemistry, where the nitrogen atoms can act as ligands. Overall, the compound's unique structure and functional groups contribute to its diverse chemical behavior and potential applications in various fields.
Formula:C10H7N3O3
InChI:InChI=1/C10H7N3O3/c14-12-6-2-1-3-10(12)9-7-8(13(15)16)4-5-11-9/h1-7H
SMILES:c1ccn(=O)c(c1)c1cc(ccn1)N(=O)=O
Synonyms:- 2-(4-Nitro-2-pyridinyl)pyridin-1-oxid
- 2-(4-Nitro-2-pyridinyl)pyridine 1-oxide
- 2-(4-Nitro-2-pyridinyl)pyridine-1-oxyde
- 4'-Nitro-2,2'-bipyridine-N-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.