CAS 84176-70-5
:Pentanoic acid, 2-hydroxy-, sodium salt (1:1)
Description:
Pentanoic acid, 2-hydroxy-, sodium salt (1:1), also known as sodium 2-hydroxypentanoate, is a sodium salt derived from pentanoic acid, which is a straight-chain carboxylic acid. This compound features a hydroxyl group (-OH) at the second carbon of the pentanoic acid chain, imparting it with both acidic and alcohol characteristics. As a sodium salt, it is typically soluble in water, making it useful in various applications, including as a buffering agent or in biochemical processes. The presence of the hydroxyl group enhances its reactivity and potential for forming hydrogen bonds, which can influence its solubility and interaction with other molecules. This compound may be utilized in food, pharmaceuticals, or cosmetic formulations due to its mild nature and compatibility with biological systems. Additionally, its properties can vary based on pH and concentration, which can affect its stability and efficacy in different environments. Overall, pentanoic acid, 2-hydroxy-, sodium salt is a versatile compound with applications in multiple fields.
Formula:C5H10O3·Na
InChI:InChI=1S/C5H10O3.Na/c1-2-3-4(6)5(7)8;/h4,6H,2-3H2,1H3,(H,7,8);
InChI key:InChIKey=WRAMQASELVSGEO-UHFFFAOYSA-N
SMILES:C(CCC)(C(O)=O)O.[Na]
Synonyms:- Pentanoic acid, 2-hydroxy-, monosodium salt
- Pentanoic acid, 2-hydroxy-, sodium salt (1:1)
- Sodium (1)-2-hydroxyvalerate
- Sodium α-hydroxypentanoate
- Sodium α-hydroxyvalerate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
DL-2-Hydroxyvaleric acid sodium salt
CAS:2-Hydroxyvaleric acid sodium salt is a fine chemical that can be used as a building block for the synthesis of more complex compounds. It is also used as a reagent in research and as a speciality chemical. The CAS number for this compound is 84176-70-5. 2-Hydoxyvaleric acid sodium salt is most commonly used in the synthesis of pharmaceuticals, pesticides, and other chemicals. It has also been shown to be useful in the synthesis of biodegradable polymers and as an intermediate in organic reactions.Formula:C5H9NaO3Purity:Min. 95%Color and Shape:PowderMolecular weight:140.11 g/mol
