CymitQuimica logo

CAS 84199-98-4

:

Methyl 3-(3-pyridyl)propionate

Description:
Methyl 3-(3-pyridyl)propionate is an organic compound characterized by its ester functional group, which is derived from the reaction of methyl alcohol and 3-(3-pyridyl)propionic acid. This compound features a pyridine ring, contributing to its aromatic properties and potential biological activity. It typically appears as a colorless to pale yellow liquid with a distinctive odor. Methyl 3-(3-pyridyl)propionate is soluble in organic solvents such as ethanol and ether, but its solubility in water is limited due to the hydrophobic nature of the pyridine ring. The compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper storage in a cool, dry place away from light is recommended to maintain its stability.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-12-9(11)5-4-8-3-2-6-10-7-8/h2-3,6-7H,4-5H2,1H3
InChI key:FQRRQPZYIYAPAV-UHFFFAOYSA-N
SMILES:COC(=O)CCc1cccnc1
Synonyms:
  • 3-(3-Pyridyl)propionic acid methyl ester
  • Methyl 3-Pyridin-3-Ylpropanoate
Found 4 products.