
CAS 84200-08-8
:2-[3-(4-Pyridinyl)propyl]-1H-isoindole-1,3(2H)-dione
Description:
2-[3-(4-Pyridinyl)propyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 84200-08-8, is a chemical compound characterized by its unique structure, which includes an isoindole core and a pyridine substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the pyridine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The isoindole moiety may impart stability and influence the compound's reactivity. Additionally, the compound's solubility, melting point, and other physical properties can vary based on its formulation and purity. It may also exhibit specific pharmacological effects, which would require further investigation through experimental studies. Overall, this compound represents a class of organic molecules that could have applications in drug development or other chemical applications, depending on its biological activity and interaction with various systems.
Formula:C16H14N2O2
InChI:InChI=1S/C16H14N2O2/c19-15-13-5-1-2-6-14(13)16(20)18(15)11-3-4-12-7-9-17-10-8-12/h1-2,5-10H,3-4,11H2
InChI key:InChIKey=NORKQDMUHKNJNN-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCCC=3C=CN=CC3)=CC=CC2
Synonyms:- 2-[3-(4-Pyridinyl)propyl]-1H-isoindole-1,3(2H)-dione
- 1H-Isoindole-1,3(2H)-dione, 2-[3-(4-pyridinyl)propyl]-
- N-[3-(4-Pyridyl)propyl]phthalimide
- [2-[3-Pyridin-4-yl]propyl]isoindole-1,3-dione
- 2-(3-(Pyridin-4-yl)propyl)isoindoline-1,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.