
CAS 84207-14-7
:Tetrahydro-4-(1-piperazinylmethyl)-2H-pyran-4-ol
Description:
Tetrahydro-4-(1-piperazinylmethyl)-2H-pyran-4-ol, with the CAS number 84207-14-7, is a chemical compound characterized by its unique structural features, including a tetrahydropyran ring and a piperazine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate polarity and potential solubility in polar solvents. The presence of the hydroxyl group contributes to its ability to form hydrogen bonds, which can influence its reactivity and interactions with biological systems. Tetrahydro-4-(1-piperazinylmethyl)-2H-pyran-4-ol may possess pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential applications in various fields, including drug design and synthesis. However, specific biological activity, toxicity, and stability would require further investigation through empirical studies. Overall, this compound exemplifies the complexity and diversity of organic molecules used in chemical and pharmaceutical research.
Formula:C10H20N2O2
InChI:InChI=1S/C10H20N2O2/c13-10(1-7-14-8-2-10)9-12-5-3-11-4-6-12/h11,13H,1-9H2
InChI key:InChIKey=VFFWCJUMODFFIZ-UHFFFAOYSA-N
SMILES:C(C1(O)CCOCC1)N2CCNCC2
Synonyms:- Tetrahydro-4-(1-piperazinylmethyl)-2H-pyran-4-ol
- 2H-Pyran-4-ol, tetrahydro-4-(1-piperazinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.