CAS 84211-28-9

3-amino-4-hydroxy-5-methoxy-benzoic acid

Description:

3-Amino-4-hydroxy-5-methoxy-benzoic acid, also known by its CAS number 84211-28-9, is an aromatic compound characterized by the presence of an amino group, a hydroxy group, and a methoxy group attached to a benzoic acid framework. This compound typically exhibits properties associated with both acidic and basic functionalities due to the carboxylic acid and amino groups, allowing it to participate in various chemical reactions, including esterification and amidation. The hydroxy and methoxy substituents contribute to its potential solubility in polar solvents and may influence its reactivity and interaction with biological systems. Additionally, the presence of these functional groups can enhance its antioxidant properties and may play a role in its biological activity. This compound is of interest in pharmaceutical and biochemical research, particularly for its potential applications in drug development and as a biochemical probe. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of study in various chemical contexts.

Formula: C₈H₉NO₄

InChI: InChI=1/C8H9NO4/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,10H,9H2,1H3,(H,11,12)