CAS 842112-54-3
:7-Chloro-3-(4-fluorophenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine
Description:
7-Chloro-3-(4-fluorophenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine is a synthetic organic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both a pyrazole and a pyrimidine ring. This compound features a chlorine atom at the 7-position and a 4-fluorophenyl group at the 3-position, along with two methyl groups at the 2 and 5 positions of the pyrazole ring. The presence of these substituents contributes to its unique chemical properties, including potential biological activity. It is often studied for its pharmacological applications, particularly in the field of medicinal chemistry, where it may exhibit properties such as anti-inflammatory or anti-cancer effects. The compound's molecular structure allows for various interactions with biological targets, making it a subject of interest in drug development. Additionally, its stability and solubility characteristics can influence its bioavailability and efficacy in therapeutic contexts. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C14H11ClFN3
InChI:InChI=1S/C14H11ClFN3/c1-8-7-12(15)19-14(17-8)13(9(2)18-19)10-3-5-11(16)6-4-10/h3-7H,1-2H3
InChI key:InChIKey=FSPWWNIMFWGYMA-UHFFFAOYSA-N
SMILES:CC=1C(=C2N(C(Cl)=CC(C)=N2)N1)C3=CC=C(F)C=C3
Synonyms:- Pyrazolo[1,5-a]pyrimidine, 7-chloro-3-(4-fluorophenyl)-2,5-dimethyl-
- 7-Chloro-3-(4-fluorophenyl)-2,5-dimethylpyrazolo[1,5-a]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.