CAS 842123-75-5
:3,5-Dichloro-α-2-propen-1-ylbenzenemethanol
Description:
3,5-Dichloro-α-2-propen-1-ylbenzenemethanol, identified by its CAS number 842123-75-5, is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with both dichloro and propenyl groups, as well as a hydroxymethyl group. This compound is likely to exhibit properties typical of chlorinated organic compounds, such as increased stability and potential bioactivity. The presence of chlorine atoms can enhance lipophilicity, influencing its solubility and reactivity. The propenyl group may contribute to its ability to participate in various chemical reactions, including polymerization or electrophilic substitution. Additionally, the hydroxymethyl group can serve as a site for further functionalization or interaction with biological systems. Overall, the compound's characteristics suggest potential applications in fields such as pharmaceuticals, agrochemicals, or materials science, although specific biological activity and toxicity profiles would require further investigation.
Formula:C10H10Cl2O
InChI:InChI=1S/C10H10Cl2O/c1-2-3-10(13)7-4-8(11)6-9(12)5-7/h2,4-6,10,13H,1,3H2
InChI key:InChIKey=LKHUTOSDFMPDOE-UHFFFAOYSA-N
SMILES:C(CC=C)(O)C1=CC(Cl)=CC(Cl)=C1
Synonyms:- 1-(3,5-Dichlorophenyl)but-3-en-1-ol
- Benzenemethanol, 3,5-dichloro-α-2-propen-1-yl-
- Benzenemethanol, 3,5-dichloro-α-2-propenyl-
- 3,5-Dichloro-α-2-propen-1-ylbenzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.