CAS 842123-76-6

4-Methoxy-3,5-dimethyl-α-2-propen-1-ylbenzenemethanol

Description:

4-Methoxy-3,5-dimethyl-α-2-propen-1-ylbenzenemethanol, with the CAS number 842123-76-6, is an organic compound characterized by its complex structure that includes a methoxy group, multiple methyl substituents, and a propenyl side chain attached to a benzene ring. This compound is likely to exhibit properties typical of phenolic compounds, including potential antioxidant activity due to the presence of the hydroxyl (-OH) group. The methoxy and methyl groups can influence its solubility, volatility, and reactivity, making it more lipophilic. The presence of the propenyl group suggests that it may participate in various chemical reactions, such as electrophilic substitutions or polymerization. Additionally, the compound may have applications in the fragrance industry or as a precursor in organic synthesis due to its unique structural features. Its stability and reactivity can be influenced by environmental factors such as temperature and pH, and it may also exhibit biological activity, warranting further investigation into its potential uses in pharmaceuticals or agrochemicals.

Formula: C₁₃H₁₈O₂

InChI: InChI=1S/C13H18O2/c1-5-6-12(14)11-7-9(2)13(15-4)10(3)8-11/h5,7-8,12,14H,1,6H2,2-4H3

InChI key: InChIKey=PQLNUTKTMGEDQH-UHFFFAOYSA-N

SMILES: O(C)C1=C(C)C=C(C(CC=C)O)C=C1C

Synonyms:

• 4-Methoxy-3,5-dimethyl-α-2-propen-1-ylbenzenemethanol
• Benzenemethanol, 4-methoxy-3,5-dimethyl-α-2-propen-1-yl-
• Benzenemethanol, 4-methoxy-3,5-dimethyl-α-2-propenyl-