CAS 842123-83-5
:4-Fluoro-3-methyl-α-2-propen-1-ylbenzenemethanol
Description:
4-Fluoro-3-methyl-α-2-propen-1-ylbenzenemethanol, identified by its CAS number 842123-83-5, is an organic compound characterized by its unique structure, which includes a fluorine atom, a methyl group, and a propenyl side chain attached to a benzene ring. This compound is likely to exhibit properties typical of aromatic alcohols, such as moderate solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The fluorine substituent can influence the compound's reactivity and polarity, potentially enhancing its biological activity or altering its interaction with other molecules. The presence of the propenyl group suggests that it may participate in various chemical reactions, including polymerization or addition reactions. Additionally, the compound's structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Overall, 4-Fluoro-3-methyl-α-2-propen-1-ylbenzenemethanol represents a complex molecule with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H13FO
InChI:InChI=1S/C11H13FO/c1-3-4-11(13)9-5-6-10(12)8(2)7-9/h3,5-7,11,13H,1,4H2,2H3
InChI key:InChIKey=UPBFFLVCAILDGS-UHFFFAOYSA-N
SMILES:C(CC=C)(O)C1=CC(C)=C(F)C=C1
Synonyms:- 4-Fluoro-3-methyl-α-2-propen-1-ylbenzenemethanol
- Benzenemethanol, 4-fluoro-3-methyl-α-2-propenyl-
- Benzenemethanol, 4-fluoro-3-methyl-α-2-propen-1-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.