CAS 842123-87-9
:2-(3-bromobenzyl)-1,3-dioxolane
Description:
2-(3-Bromobenzyl)-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which features a five-membered cyclic ether containing two oxygen atoms. The presence of a bromobenzyl group at the 2-position of the dioxolane contributes to its reactivity and potential applications in organic synthesis. This compound typically exhibits moderate polarity due to the electronegative bromine atom and the dioxolane moiety, influencing its solubility in various organic solvents. The bromine substituent can participate in nucleophilic substitution reactions, making it a useful intermediate in the synthesis of more complex molecules. Additionally, the dioxolane ring can undergo ring-opening reactions under certain conditions, further expanding its utility in synthetic chemistry. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled. Overall, 2-(3-bromobenzyl)-1,3-dioxolane is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C10H11BrO2
InChI:InChI=1/C10H11BrO2/c11-9-3-1-2-8(6-9)7-10-12-4-5-13-10/h1-3,6,10H,4-5,7H2
Synonyms:- 1,3-Dioxolane, 2-[(3-bromophenyl)methyl]-
- 2-(3-Bromobenzyl)-1,3-dioxolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
