CymitQuimica logo

CAS 842123-88-0

:

2-[(2,5-Difluorophenyl)methyl]-1,3-dioxolane

Description:
2-[(2,5-Difluorophenyl)methyl]-1,3-dioxolane is an organic compound characterized by its unique structure, which includes a dioxolane ring and a difluorophenyl group. The presence of the dioxolane moiety suggests that it may exhibit properties typical of cyclic ethers, such as being relatively stable and having moderate polarity. The difluorophenyl substituent introduces fluorine atoms, which can enhance the compound's lipophilicity and potentially influence its reactivity and biological activity. This compound may be of interest in medicinal chemistry due to the presence of fluorine, which is known to improve metabolic stability and bioavailability in drug design. Additionally, the specific arrangement of the difluorophenyl group can affect the compound's electronic properties, potentially impacting its interactions with biological targets. Overall, 2-[(2,5-Difluorophenyl)methyl]-1,3-dioxolane is a compound that may possess interesting chemical and pharmacological properties, warranting further investigation in various applications, including pharmaceuticals and agrochemicals.
Formula:C10H10F2O2
InChI:InChI=1/C10H10F2O2/c11-8-1-2-9(12)7(5-8)6-10-13-3-4-14-10/h1-2,5,10H,3-4,6H2
InChI key:InChIKey=MGURYLNNMDCLSU-UHFFFAOYSA-N
SMILES:C(C1=C(F)C=CC(F)=C1)C2OCCO2
Synonyms:
  • 1,3-Dioxolane, 2-[(2,5-difluorophenyl)methyl]-
  • 2-[(2,5-Difluorophenyl)methyl]-1,3-dioxolane
  • 2-(2,5-Difluorobenzyl)-1,3-dioxolane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.