CAS 842123-91-5

2-(2-chlorobenzyl)-1,3-dioxolane

Description:

2-(2-Chlorobenzyl)-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which features a five-membered cyclic ether containing two oxygen atoms. The presence of a chlorobenzyl group at the 2-position of the dioxolane contributes to its chemical reactivity and potential applications in organic synthesis. This compound typically exhibits moderate polarity due to the electronegative chlorine atom, which can influence its solubility in various solvents. Its molecular structure suggests potential for interactions such as hydrogen bonding, which may affect its boiling and melting points. Additionally, the chlorobenzyl moiety may impart biological activity, making it of interest in medicinal chemistry. The compound's CAS number, 842123-91-5, allows for easy identification in chemical databases, facilitating research and development in fields such as pharmaceuticals and agrochemicals. Overall, 2-(2-chlorobenzyl)-1,3-dioxolane is a versatile compound with unique properties that can be leveraged in various chemical applications.

Formula: C₁₀H₁₁ClO₂

InChI: InChI=1/C10H11ClO2/c11-9-4-2-1-3-8(9)7-10-12-5-6-13-10/h1-4,10H,5-7H2

SMILES: c1ccc(c(c1)CC1OCCO1)Cl

Synonyms:

• 1,3-Dioxolane, 2-[(2-chlorophenyl)methyl]-
• 2-(2-Chlorobenzyl)-1,3-dioxolane
• 1-CHLORO-2-(1,3-DIOXOLAN-2-YLMETHYL)BENZENE