CAS 842123-92-6

1,3-Dioxolane, 2-[(2-methoxyphenyl)methyl]-

Description:

1,3-Dioxolane, 2-[(2-methoxyphenyl)methyl]- is a chemical compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms and three carbon atoms. This compound features a methoxyphenyl group, indicating the presence of a methoxy (-OCH3) substituent on a phenyl ring, which is attached to a carbon atom of the dioxolane. The presence of the methoxy group can influence the compound's solubility and reactivity, often enhancing its lipophilicity. The dioxolane moiety is known for its stability and is commonly used as a solvent or in the synthesis of various organic compounds. The compound's molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the presence of both the dioxolane and aromatic functionalities may impart unique chemical properties, such as specific reactivity patterns in electrophilic or nucleophilic reactions. Overall, this compound exemplifies the diverse chemistry associated with cyclic ethers and aromatic compounds.

Formula: C₁₁H₁₄O₃

InChI: InChI=1S/C11H14O3/c1-12-10-5-3-2-4-9(10)8-11-13-6-7-14-11/h2-5,11H,6-8H2,1H3

InChI key: InChIKey=AXULXOLGXYVIOO-UHFFFAOYSA-N

SMILES: C(C1=C(OC)C=CC=C1)C2OCCO2

Synonyms:

• 1,3-Dioxolane, 2-[(2-methoxyphenyl)methyl]-
• 2-(2-Methoxybenzyl)-1,3-dioxolane