CymitQuimica logo

CAS 842123-93-7

:

2-(3-chlorobenzyl)-1,3-dioxolane

Description:
2-(3-Chlorobenzyl)-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms. The presence of a 3-chlorobenzyl group enhances its chemical properties, potentially influencing its reactivity and solubility. This compound is typically colorless to pale yellow in appearance and may exhibit a moderate to low volatility. It is likely to be soluble in organic solvents, such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic component. The chlorobenzyl moiety may impart biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the dioxolane structure can participate in various chemical reactions, including nucleophilic substitutions and ring-opening reactions, which can be exploited in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C10H11ClO2
InChI:InChI=1/C10H11ClO2/c11-9-3-1-2-8(6-9)7-10-12-4-5-13-10/h1-3,6,10H,4-5,7H2
SMILES:c1cc(cc(c1)Cl)CC1OCCO1
Synonyms:
  • 1,3-Dioxolane, 2-[(3-chlorophenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.