CymitQuimica logo

CAS 842123-94-8

:

2-[(2-Fluorophenyl)methyl]-1,3-dioxolane

Description:
2-[(2-Fluorophenyl)methyl]-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring, which can influence the compound's reactivity and physical properties. This compound is likely to exhibit moderate polarity due to the electronegative fluorine atom, which can affect its solubility in various solvents. The dioxolane moiety may impart stability and influence the compound's interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods, providing insights into its behavior in different chemical environments. Overall, 2-[(2-Fluorophenyl)methyl]-1,3-dioxolane represents a unique structure with potential utility in various chemical applications.
Formula:C10H11FO2
InChI:InChI=1S/C10H11FO2/c11-9-4-2-1-3-8(9)7-10-12-5-6-13-10/h1-4,10H,5-7H2
InChI key:InChIKey=VQIMXWOVHDDRQQ-UHFFFAOYSA-N
SMILES:C(C1=C(F)C=CC=C1)C2OCCO2
Synonyms:
  • 1,3-Dioxolane, 2-[(2-fluorophenyl)methyl]-
  • 2-(1,3-Dioxolan-2-ylmethyl)-1-fluorobenzene
  • 2-[(2-Fluorophenyl)methyl]-1,3-dioxolane
  • 2-(2-Fluorobenzyl)-1,3-dioxolane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.