CymitQuimica logo

CAS 842123-95-9

:

2-(3-methoxybenzyl)-1,3-dioxolane

Description:
2-(3-Methoxybenzyl)-1,3-dioxolane is an organic compound characterized by its unique structure, which includes a dioxolane ring and a methoxy-substituted benzyl group. The presence of the dioxolane moiety suggests that it may exhibit properties typical of cyclic ethers, such as being relatively stable and having moderate polarity. The methoxy group enhances its solubility in organic solvents and may influence its reactivity, particularly in electrophilic aromatic substitution reactions. This compound may also exhibit interesting biological activities due to the presence of the aromatic ring, which can participate in various interactions with biological targets. Additionally, the specific arrangement of functional groups can affect its physical properties, such as boiling point, melting point, and solubility. Overall, 2-(3-methoxybenzyl)-1,3-dioxolane is a compound of interest in organic synthesis and medicinal chemistry, potentially serving as a precursor or intermediate in the development of pharmaceuticals or other functional materials.
Formula:C11H14O3
InChI:InChI=1/C11H14O3/c1-12-10-4-2-3-9(7-10)8-11-13-5-6-14-11/h2-4,7,11H,5-6,8H2,1H3
Synonyms:
  • 1,3-Dioxolane, 2-[(3-methoxyphenyl)methyl]-
  • 2-(3-Methoxybenzyl)-1,3-dioxolane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.