CymitQuimica logo

CAS 842123-99-3

:

2-[(3-Fluorophenyl)methyl]-1,3-dioxolane

Description:
2-[(3-Fluorophenyl)methyl]-1,3-dioxolane is an organic compound characterized by its unique structure, which includes a dioxolane ring and a fluorophenyl group. The presence of the dioxolane moiety contributes to its potential as a solvent or intermediate in organic synthesis, while the fluorine atom on the phenyl ring can enhance lipophilicity and influence biological activity. This compound typically exhibits moderate polarity due to the dioxolane ring, which can affect its solubility in various solvents. Additionally, the fluorine substituent may impart specific electronic properties, making it of interest in medicinal chemistry for the development of pharmaceuticals. The compound's stability and reactivity can be influenced by the dioxolane structure, which is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and ring-opening reactions. Overall, 2-[(3-Fluorophenyl)methyl]-1,3-dioxolane is a versatile compound with potential applications in both synthetic chemistry and drug development.
Formula:C10H11FO2
InChI:InChI=1/C10H11FO2/c11-9-3-1-2-8(6-9)7-10-12-4-5-13-10/h1-3,6,10H,4-5,7H2
InChI key:InChIKey=GOLHCIYPANJQAL-UHFFFAOYSA-N
SMILES:C(C1=CC(F)=CC=C1)C2OCCO2
Synonyms:
  • 1,3-Dioxolane, 2-[(3-fluorophenyl)methyl]-
  • 2-[(3-Fluorophenyl)methyl]-1,3-dioxolane
  • 2-(3-Fluorobenzyl)-1,3-dioxolane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.