CAS 842124-00-9

1-(3,4-Difluorophenyl)-3-(1,3-dioxolan-2-yl)-1-propanone

Description:

1-(3,4-Difluorophenyl)-3-(1,3-dioxolan-2-yl)-1-propanone, with the CAS number 842124-00-9, is an organic compound characterized by its unique molecular structure, which includes a propanone moiety and a dioxolane ring. The presence of the difluorophenyl group contributes to its potential reactivity and influences its physical properties, such as solubility and boiling point. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atoms and the dioxolane ring, which can affect its interactions with other molecules. It may also possess interesting biological activities, making it a candidate for pharmaceutical applications. The dioxolane ring can provide stability and may participate in various chemical reactions, including nucleophilic attacks. Overall, this compound's unique structure and functional groups suggest it could be of interest in synthetic organic chemistry and medicinal chemistry research. However, specific properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications.

Formula: C₁₂H₁₂F₂O₃

InChI: InChI=1S/C12H12F2O3/c13-9-2-1-8(7-10(9)14)11(15)3-4-12-16-5-6-17-12/h1-2,7,12H,3-6H2

InChI key: InChIKey=BAQVKFWFMLAPDA-UHFFFAOYSA-N

SMILES: C(CCC1OCCO1)(=O)C2=CC(F)=C(F)C=C2

Synonyms:

• 1-Propanone, 1-(3,4-difluorophenyl)-3-(1,3-dioxolan-2-yl)-
• 1-(3,4-Difluorophenyl)-3-(1,3-dioxolan-2-yl)-1-propanone