
CAS 842124-02-1
:3-(1,3-Dioxolan-2-yl)-1-(3-fluorophenyl)-1-propanone
Description:
3-(1,3-Dioxolan-2-yl)-1-(3-fluorophenyl)-1-propanone, with the CAS number 842124-02-1, is an organic compound characterized by its unique structural features. It contains a dioxolane ring, which is a five-membered cyclic ether with two oxygen atoms, contributing to its stability and reactivity. The presence of a fluorophenyl group enhances its electronic properties, potentially influencing its reactivity and interactions in various chemical environments. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atom, which can affect solubility and intermolecular interactions. Additionally, the ketone functional group (propanone) suggests that it may participate in nucleophilic addition reactions. Its specific applications may vary, but compounds of this nature are often explored in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Overall, the combination of the dioxolane and fluorophenyl moieties suggests a compound with interesting chemical behavior and potential utility in various fields of chemistry.
Formula:C12H13FO3
InChI:InChI=1S/C12H13FO3/c13-10-3-1-2-9(8-10)11(14)4-5-12-15-6-7-16-12/h1-3,8,12H,4-7H2
InChI key:InChIKey=FQKMRPDWGXLDMH-UHFFFAOYSA-N
SMILES:C(CCC1OCCO1)(=O)C2=CC(F)=CC=C2
Synonyms:- 3-(1,3-Dioxolan-2-yl)-1-(3-fluorophenyl)-1-propanone
- 1-Propanone, 3-(1,3-dioxolan-2-yl)-1-(3-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.