
CAS 842124-03-2
:1-(3,5-Difluorophenyl)-3-(1,3-dioxolan-2-yl)-1-propanone
Description:
1-(3,5-Difluorophenyl)-3-(1,3-dioxolan-2-yl)-1-propanone, with the CAS number 842124-03-2, is an organic compound characterized by its unique structural features. It contains a propanone moiety, which is a ketone functional group, and is substituted with a 3,5-difluorophenyl group, indicating the presence of two fluorine atoms on the aromatic ring. Additionally, the compound includes a 1,3-dioxolane ring, a five-membered cyclic ether that contributes to its chemical reactivity and stability. The presence of fluorine atoms typically enhances the lipophilicity and metabolic stability of the compound, making it of interest in pharmaceutical applications. The dioxolane ring can participate in various chemical reactions, such as nucleophilic attacks or ring-opening reactions, which may be useful in synthetic chemistry. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C12H12F2O3
InChI:InChI=1S/C12H12F2O3/c13-9-5-8(6-10(14)7-9)11(15)1-2-12-16-3-4-17-12/h5-7,12H,1-4H2
InChI key:InChIKey=YVHFPRYQFUUNAX-UHFFFAOYSA-N
SMILES:C(CCC1OCCO1)(=O)C2=CC(F)=CC(F)=C2
Synonyms:- 1-(3,5-Difluorophenyl)-3-(1,3-dioxolan-2-yl)-1-propanone
- 1-Propanone, 1-(3,5-difluorophenyl)-3-(1,3-dioxolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.