CAS 842124-12-3

2-(2,4-difluorobenzyl)-1,3-dioxolane

Description:

2-(2,4-Difluorobenzyl)-1,3-dioxolane is an organic compound characterized by its unique structure, which includes a dioxolane ring and a difluorobenzyl substituent. The presence of the dioxolane moiety contributes to its potential as a solvent or intermediate in organic synthesis, while the difluorobenzyl group may enhance its reactivity and influence its physical properties, such as polarity and solubility. This compound is likely to exhibit moderate stability under standard conditions, but its reactivity can be influenced by the electron-withdrawing effects of the fluorine atoms. The compound may also display interesting biological activities, making it a candidate for further research in medicinal chemistry. Its CAS number, 842124-12-3, allows for easy identification and retrieval of information in chemical databases. Overall, 2-(2,4-difluorobenzyl)-1,3-dioxolane is a noteworthy compound in the realm of organic chemistry, with potential applications in various fields.

Formula: C₁₀H₁₀F₂O₂

InChI: InChI=1/C10H10F2O2/c11-8-2-1-7(9(12)6-8)5-10-13-3-4-14-10/h1-2,6,10H,3-5H2

SMILES: c1cc(cc(c1CC1OCCO1)F)F

Synonyms:

• 1,3-Dioxolane, 2-[(2,4-difluorophenyl)methyl]-
• 2-(2,4-Difluorobenzyl)-1,3-dioxolane