CymitQuimica logo

CAS 842124-26-9

:

2-fluoro-1-methyl-4-prop-2-en-1-ylbenzene

Description:
2-Fluoro-1-methyl-4-prop-2-en-1-ylbenzene, also known by its CAS number 842124-26-9, is an organic compound characterized by the presence of a fluorine atom, a methyl group, and a prop-2-en-1-yl substituent attached to a benzene ring. This compound features a conjugated system due to the presence of the prop-2-en-1-yl group, which can impart unique reactivity and stability characteristics, making it of interest in various chemical applications, including organic synthesis and materials science. The fluorine atom enhances the compound's electronegativity, potentially influencing its reactivity and interaction with other chemical species. Additionally, the presence of the methyl group can affect steric hindrance and electronic properties, which may play a role in its behavior in chemical reactions. Overall, 2-fluoro-1-methyl-4-prop-2-en-1-ylbenzene is a valuable compound for research and industrial applications, particularly in the development of new materials and pharmaceuticals.
Formula:C10H11F
InChI:InChI=1/C10H11F/c1-3-4-9-6-5-8(2)10(11)7-9/h3,5-7H,1,4H2,2H3
SMILES:C=CCc1ccc(C)c(c1)F
Synonyms:
  • 4-Allyl-2-fluoro-1-methylbenzene
  • Benzene, 2-fluoro-1-methyl-4-(2-propen-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.