CAS 842136-33-8

2-[(3-Methylphenyl)methoxy]acetaldehyde

Description:

2-[(3-Methylphenyl)methoxy]acetaldehyde, with the CAS number 842136-33-8, is an organic compound characterized by its aldehyde functional group and ether linkage. This compound features a methoxy group attached to an acetaldehyde moiety, with a 3-methylphenyl substituent, which contributes to its aromatic properties. The presence of the methyl group on the phenyl ring enhances its hydrophobic characteristics, potentially affecting its solubility in various solvents. Typically, compounds like this may exhibit moderate volatility and can participate in various chemical reactions, including nucleophilic additions due to the reactive aldehyde group. Its structure suggests potential applications in organic synthesis, fragrance formulation, or as an intermediate in the production of more complex molecules. Additionally, the compound's physical properties, such as boiling point and melting point, would be influenced by its molecular weight and functional groups, making it relevant in both industrial and research settings. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₀H₁₂O₂

InChI: InChI=1S/C10H12O2/c1-9-3-2-4-10(7-9)8-12-6-5-11/h2-5,7H,6,8H2,1H3

InChI key: InChIKey=NCUZOXDJLWKRFX-UHFFFAOYSA-N

SMILES: C(OCC=O)C1=CC(C)=CC=C1

Synonyms:

• 2-[(3-Methylphenyl)methoxy]acetaldehyde
• 2-((3-Methylbenzyl)oxy)acetaldehyde
• Acetaldehyde, 2-[(3-methylphenyl)methoxy]-
• Acetaldehyde, [(3-methylphenyl)methoxy]-