CAS 842136-59-8
:5-Bromo-2-chloro-N-methoxy-N-methylbenzamide
Description:
5-Bromo-2-chloro-N-methoxy-N-methylbenzamide is a chemical compound characterized by its specific functional groups and structural features. It contains a benzamide core, which is a derivative of benzoic acid where the carboxylic acid group is replaced by an amide group. The presence of bromine and chlorine atoms on the aromatic ring contributes to its reactivity and potential applications in various chemical reactions. The methoxy (-OCH3) and methyl (-CH3) groups attached to the nitrogen atom enhance its solubility and may influence its biological activity. This compound may exhibit properties such as antimicrobial or anticancer activity, making it of interest in pharmaceutical research. Its molecular structure suggests that it could participate in electrophilic aromatic substitution reactions due to the electron-withdrawing effects of the halogen substituents. Additionally, the presence of halogens can affect the compound's stability and reactivity in different environments. Overall, 5-Bromo-2-chloro-N-methoxy-N-methylbenzamide is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C9H9BrClNO2
InChI:InChI=1S/C9H9BrClNO2/c1-12(14-2)9(13)7-5-6(10)3-4-8(7)11/h3-5H,1-2H3
InChI key:InChIKey=VUXHGIZYRNNOSE-UHFFFAOYSA-N
SMILES:C(N(OC)C)(=O)C1=C(Cl)C=CC(Br)=C1
Synonyms:- Benzamide, 5-bromo-2-chloro-N-methoxy-N-methyl-
- 5-Bromo-2-chloro-N-methoxy-N-methylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
