CymitQuimica logo

CAS 842137-56-8

:

Benzoic acid, 4-[4-(chloromethyl)-2-thiazolyl]-

Description:
Benzoic acid, 4-[4-(chloromethyl)-2-thiazolyl]- is an organic compound characterized by its benzoic acid backbone, which features a thiazole ring substituted with a chloromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The thiazole moiety contributes to its biological activity, often making it of interest in pharmaceutical applications. The chloromethyl group can enhance reactivity, allowing for further chemical modifications. As with many benzoic acid derivatives, it may display antimicrobial or antifungal properties, making it relevant in various industrial and medicinal contexts. Safety data should be consulted for handling, as the chloromethyl group can pose hazards. Overall, this compound exemplifies the complexity and utility of substituted aromatic acids in chemical synthesis and application.
Formula:C11H8ClNO2S
InChI:InChI=1S/C11H8ClNO2S/c12-5-9-6-16-10(13-9)7-1-3-8(4-2-7)11(14)15/h1-4,6H,5H2,(H,14,15)
InChI key:InChIKey=MTFQTWYTXNKGAU-UHFFFAOYSA-N
SMILES:C(Cl)C=1N=C(SC1)C2=CC=C(C(O)=O)C=C2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.