CAS 842140-27-6
:1-(2-bromoprop-2-en-1-yl)-4-tert-butylbenzene
Description:
1-(2-bromoprop-2-en-1-yl)-4-tert-butylbenzene, identified by its CAS number 842140-27-6, is an organic compound characterized by the presence of a brominated allyl group attached to a tert-butyl-substituted phenyl ring. This compound features a bromine atom, which contributes to its reactivity, particularly in nucleophilic substitution reactions. The tert-butyl group enhances the steric bulk around the aromatic ring, influencing its electronic properties and reactivity. The presence of the double bond in the allyl group allows for potential participation in various addition reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's structure suggests it may exhibit hydrophobic characteristics due to the large tert-butyl group, which can affect its solubility in different solvents. Overall, this compound's unique structural features make it of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C13H17Br
InChI:InChI=1/C13H17Br/c1-10(14)9-11-5-7-12(8-6-11)13(2,3)4/h5-8H,1,9H2,2-4H3
SMILES:C=C(Cc1ccc(cc1)C(C)(C)C)Br
Synonyms:- Benzene, 1-(2-bromo-2-propen-1-yl)-4-(1,1-dimethylethyl)-
- 1-(2-Bromoprop-2-en-1-yl)-4-tert-butylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.