CAS 842140-33-4

1-(2-Bromo-2-propen-1-yl)-3,5-dichlorobenzene

Description:

1-(2-Bromo-2-propen-1-yl)-3,5-dichlorobenzene, with the CAS number 842140-33-4, is an organic compound characterized by its unique structure that includes a dichlorobenzene moiety and a propenyl group substituted with a bromine atom. This compound typically exhibits a non-polar nature due to the presence of the aromatic ring, which contributes to its hydrophobic characteristics. The bromopropene substituent introduces reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and polymerization processes. The dichlorobenzene component enhances its stability and may influence its solubility in organic solvents. Additionally, the presence of halogens can impart specific properties such as increased density and potential biological activity. As with many halogenated compounds, it is essential to consider environmental and health implications, as they may exhibit toxicity or persistence in the environment. Overall, this compound's unique structural features make it of interest in both synthetic organic chemistry and materials science.

Formula: C₉H₇BrCl₂

InChI: InChI=1S/C9H7BrCl2/c1-6(10)2-7-3-8(11)5-9(12)4-7/h3-5H,1-2H2

InChI key: InChIKey=ZOMKQRJTDJYYEZ-UHFFFAOYSA-N

SMILES: C(C(Br)=C)C1=CC(Cl)=CC(Cl)=C1

Synonyms:

• 1-(2-Bromo-2-propen-1-yl)-3,5-dichlorobenzene
• Benzene, 1-(2-bromo-2-propen-1-yl)-3,5-dichloro-
• Benzene, 1-(2-bromo-2-propenyl)-3,5-dichloro-
• 1-(2-Bromoprop-2-en-1-yl)-3,5-dichlorobenzene

2-Bromo-3-(3,5-dichlorophenyl)-1-propene

CAS: 842140-33-4

Formula: C₉H₇BrCl₂

Purity: 97.0%

Molecular weight: 265.96

Ref: 10-F022338