CAS 842140-36-7

4-(2-bromoprop-2-en-1-yl)-1,2-dimethoxybenzene

Description:

4-(2-bromoprop-2-en-1-yl)-1,2-dimethoxybenzene, identified by its CAS number 842140-36-7, is an organic compound characterized by its aromatic structure and the presence of both bromine and methoxy functional groups. The compound features a dimethoxybenzene core, which contributes to its potential reactivity and solubility properties. The bromopropenyl substituent introduces a double bond and a bromine atom, enhancing its electrophilic character and making it a candidate for various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions. This compound may exhibit interesting physical properties, including moderate volatility and solubility in organic solvents, while its reactivity can be influenced by the presence of the bromine atom and the methoxy groups. Additionally, the compound's structure suggests potential applications in organic synthesis, particularly in the development of more complex molecules or as intermediates in pharmaceutical chemistry. As with many organic compounds, safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.

Formula: C₁₁H₁₃BrO₂

InChI: InChI=1/C11H13BrO2/c1-8(12)6-9-4-5-10(13-2)11(7-9)14-3/h4-5,7H,1,6H2,2-3H3

SMILES: C=C(Cc1ccc(c(c1)OC)OC)Br

Synonyms:

• Benzene, 4-(2-bromo-2-propen-1-yl)-1,2-dimethoxy-
• 4-(2-Bromoprop-2-en-1-yl)-1,2-dimethoxybenzene