CAS 842140-39-0
:1-(2-bromoprop-2-en-1-yl)-4-(ethylsulfanyl)benzene
Description:
1-(2-bromoprop-2-en-1-yl)-4-(ethylsulfanyl)benzene is an organic compound characterized by its unique structure, which includes a bromopropene moiety and an ethylthio group attached to a benzene ring. The presence of the bromine atom introduces reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The ethylsulfanyl group enhances the compound's solubility in organic solvents and may influence its electronic properties, potentially affecting its reactivity and interaction with other molecules. This compound may exhibit interesting biological activities due to the presence of both the bromine and the sulfur-containing group, which can participate in various biochemical interactions. Its molecular structure suggests that it could be used in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many organobromine compounds, safety precautions should be taken during handling due to potential toxicity and environmental concerns associated with brominated compounds.
Formula:C11H13BrS
InChI:InChI=1/C11H13BrS/c1-3-13-11-6-4-10(5-7-11)8-9(2)12/h4-7H,2-3,8H2,1H3
InChI key:InChIKey=MJWXVHGSTOFZTQ-UHFFFAOYSA-N
SMILES:CCSc1ccc(cc1)CC(=C)Br
Synonyms:- 1-(2-Bromo-2-propen-1-yl)-4-(ethylthio)benzene
- 4-(2-Bromoprop-2-en-1-yl)phenyl ethyl sulfide
- Benzene, 1-(2-bromo-2-propen-1-yl)-4-(ethylthio)-
- Benzene, 1-(2-bromo-2-propenyl)-4-(ethylthio)-
- 1-(2-Bromoprop-2-en-1-yl)-4-(ethylsulfanyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.