CAS 842140-41-4

4-(2-bromoprop-2-en-1-yl)-2-fluoro-1-methylbenzene

Description:

4-(2-bromoprop-2-en-1-yl)-2-fluoro-1-methylbenzene, identified by its CAS number 842140-41-4, is an organic compound characterized by the presence of a fluorine atom, a brominated alkene side chain, and a methyl-substituted aromatic ring. The structure features a benzene ring with a fluorine atom at the para position relative to the methyl group, and a 2-bromoprop-2-en-1-yl group attached at the ortho position. This compound exhibits properties typical of halogenated aromatic compounds, such as increased reactivity due to the presence of the bromine and fluorine substituents, which can influence its chemical behavior in reactions, including electrophilic aromatic substitution and nucleophilic addition. The presence of the double bond in the side chain also suggests potential for further reactivity, such as polymerization or addition reactions. Additionally, the compound's physical properties, such as boiling point and solubility, would be influenced by its molecular structure and the nature of its substituents. Overall, this compound may have applications in organic synthesis and materials science.

Formula: C₁₀H₁₀BrF

InChI: InChI=1/C10H10BrF/c1-7-3-4-9(5-8(2)11)6-10(7)12/h3-4,6H,2,5H2,1H3

SMILES: Cc1ccc(CC(=C)Br)cc1F

Synonyms:

• Benzene, 4-(2-bromo-2-propen-1-yl)-2-fluoro-1-methyl-
• 4-(2-Bromoprop-2-en-1-yl)-2-fluoro-1-methylbenzene

4-(2-Bromoallyl)-2-fluorotoluene

CAS: 842140-41-4

4-(2-Bromoallyl)-2-fluorotoluene

Purity: 97%

Molecular weight: 229.09g/mol

Ref: 54-PC2429