CymitQuimica logo

CAS 842140-50-5

:

3-oxo-3-(3,4,5-trifluorophenyl)propanenitrile

Description:
3-Oxo-3-(3,4,5-trifluorophenyl)propanenitrile, with the CAS number 842140-50-5, is an organic compound characterized by its functional groups, including a ketone and a nitrile. The presence of the trifluorophenyl group indicates that the compound has significant fluorine substitution, which can enhance its lipophilicity and influence its reactivity and biological activity. The nitrile group contributes to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound may exhibit interesting properties such as increased stability and altered solubility due to the trifluoromethyl groups. Additionally, the structural arrangement suggests potential applications in pharmaceuticals or agrochemicals, where fluorinated compounds are often sought for their unique properties. Overall, 3-oxo-3-(3,4,5-trifluorophenyl)propanenitrile is a versatile compound with characteristics that make it valuable in various chemical contexts.
Formula:C9H4F3NO
InChI:InChI=1/C9H4F3NO/c10-6-3-5(8(14)1-2-13)4-7(11)9(6)12/h3-4H,1H2
SMILES:C(C#N)C(=O)c1cc(c(c(c1)F)F)F
Synonyms:
  • Benzenepropanenitrile, 3,4,5-trifluoro-beta-oxo-
  • 3-Oxo-3-(3,4,5-trifluorophenyl)propanenitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.