CAS 842140-51-6

3-(3,5-difluorophenyl)-3-oxopropanenitrile

Description:

3-(3,5-Difluorophenyl)-3-oxopropanenitrile, with the CAS number 842140-51-6, is an organic compound characterized by its unique structure, which includes a propanenitrile moiety and a difluorophenyl group. This compound features a carbonyl group (ketone) adjacent to a nitrile functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the difluorophenyl group enhances its electronic properties, making it of interest in medicinal chemistry and material science. Typically, compounds like this may exhibit moderate to high polarity due to the presence of the nitrile and carbonyl groups, influencing their solubility in various solvents. Additionally, the difluorination can impart unique biological activity, making it a candidate for further investigation in drug development. As with many organic compounds, safety data should be consulted for handling and storage, as well as potential environmental impacts. Overall, 3-(3,5-difluorophenyl)-3-oxopropanenitrile represents a versatile structure with potential applications in various fields of chemistry.

Formula: C₉H₅F₂NO

InChI: InChI=1/C9H5F2NO/c10-7-3-6(4-8(11)5-7)9(13)1-2-12/h3-5H,1H2

SMILES: C(C#N)C(=O)c1cc(cc(c1)F)F

Synonyms:

• Benzenepropanenitrile, 3,5-difluoro-beta-oxo-

3,5-Difluorobenzoylacetonitrile

CAS: 842140-51-6

Formula: C₉H₅F₂NO

Purity: 97%

Molecular weight: 181.1389

Ref: IN-DA008GN2

3,5-Difluorobenzoylacetonitrile

CAS: 842140-51-6

3,5-Difluorobenzoylacetonitrile

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 181.14g/mol

Ref: 54-PC9047

3,5-Difluorobenzoylacetonitrile

CAS: 842140-51-6

Formula: C₉H₅F₂NO

Purity: 97%

Molecular weight: 181.142

Ref: 10-F022383