CAS 842140-57-2
:3,4-Difluoro-α-(4-methylphenyl)benzenemethanol
Description:
3,4-Difluoro-α-(4-methylphenyl)benzenemethanol, with the CAS number 842140-57-2, is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with two fluorine atoms at the 3 and 4 positions, and a para-methylphenyl group attached to the alpha position of the benzenemethanol moiety. This compound is likely to exhibit properties typical of aromatic alcohols, including potential solubility in organic solvents and moderate polarity due to the hydroxyl (-OH) group. The presence of fluorine atoms can enhance the compound's lipophilicity and influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the methyl group on the para position may affect the steric and electronic properties, potentially impacting its biological activity. As with many fluorinated compounds, it may also exhibit unique interactions with biological systems, warranting further investigation into its safety and efficacy in relevant applications.
Formula:C14H12F2O
InChI:InChI=1S/C14H12F2O/c1-9-2-4-10(5-3-9)14(17)11-6-7-12(15)13(16)8-11/h2-8,14,17H,1H3
InChI key:InChIKey=LVAMGOVTYHHEHV-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(F)=C(F)C=C1)C2=CC=C(C)C=C2
Synonyms:- Benzenemethanol, 3,4-difluoro-α-(4-methylphenyl)-
- 3,4-Difluoro-α-(4-methylphenyl)benzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.