CAS 842140-61-8
:4-(Ethylthio)-α-(4-methylphenyl)benzenemethanol
Description:
4-(Ethylthio)-α-(4-methylphenyl)benzenemethanol, with the CAS number 842140-61-8, is an organic compound characterized by its complex structure, which includes a benzenemethanol core substituted with an ethylthio group and a para-methylphenyl group. This compound typically exhibits properties associated with aromatic compounds, such as a relatively high boiling point and moderate solubility in organic solvents. The presence of the ethylthio group may impart unique reactivity, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions or coupling reactions. Additionally, the compound's structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis, particularly in the development of more complex molecules. Its specific physical and chemical properties, such as melting point, boiling point, and spectral characteristics, would need to be determined experimentally or sourced from reliable chemical databases for precise applications. Overall, this compound represents a fascinating example of functionalized aromatic chemistry.
Formula:C16H18OS
InChI:InChI=1S/C16H18OS/c1-3-18-15-10-8-14(9-11-15)16(17)13-6-4-12(2)5-7-13/h4-11,16-17H,3H2,1-2H3
InChI key:InChIKey=ONFODKILCHPYTB-UHFFFAOYSA-N
SMILES:C(O)(C1=CC=C(SCC)C=C1)C2=CC=C(C)C=C2
Synonyms:- 4-(Ethylthio)-α-(4-methylphenyl)benzenemethanol
- Benzenemethanol, 4-(ethylthio)-α-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.