CAS 842140-62-9
:3-Methoxy-α-(4-methylphenyl)benzenemethanol
Description:
3-Methoxy-α-(4-methylphenyl)benzenemethanol, identified by its CAS number 842140-62-9, is an organic compound characterized by its complex structure, which includes a methoxy group and a phenyl ring substituted with a methyl group. This compound typically exhibits properties common to aromatic alcohols, such as moderate solubility in organic solvents and potential solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The methoxy group contributes to its electron-donating characteristics, which can influence its reactivity and interaction with other chemical species. Additionally, the presence of the methylphenyl substituent may enhance its hydrophobic properties, affecting its behavior in biological systems and its potential applications in pharmaceuticals or as a chemical intermediate. The compound's molecular structure suggests it may participate in hydrogen bonding, influencing its physical properties such as boiling and melting points. Overall, 3-Methoxy-α-(4-methylphenyl)benzenemethanol is a compound of interest in organic chemistry, particularly in studies related to aromatic compounds and their derivatives.
Formula:C15H16O2
InChI:InChI=1S/C15H16O2/c1-11-6-8-12(9-7-11)15(16)13-4-3-5-14(10-13)17-2/h3-10,15-16H,1-2H3
InChI key:InChIKey=QPKHKSGBPXFYFS-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(OC)=CC=C1)C2=CC=C(C)C=C2
Synonyms:- (3-Methoxyphenyl)(4-methylphenyl)methanol
- Benzenemethanol, 3-methoxy-α-(4-methylphenyl)-
- 3-Methoxy-4′-methylbenzhydrol
- 3-Methoxy-α-(4-methylphenyl)benzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.