CAS 842140-72-1
:3-Chloro-α-(3-methylphenyl)benzenemethanol
Description:
3-Chloro-α-(3-methylphenyl)benzenemethanol, identified by its CAS number 842140-72-1, is an organic compound characterized by its complex aromatic structure. It features a chlorinated benzene ring and a benzenemethanol moiety, which contributes to its potential as a versatile intermediate in organic synthesis. The presence of the chloro group enhances its reactivity, making it suitable for various chemical transformations, including nucleophilic substitutions and coupling reactions. The 3-methylphenyl substituent adds steric bulk and can influence the compound's solubility and reactivity. Typically, compounds of this nature may exhibit moderate to high lipophilicity, affecting their behavior in biological systems and their potential applications in pharmaceuticals or agrochemicals. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular structure and functional groups. Safety and handling considerations are essential, as chlorinated compounds can pose environmental and health risks. Overall, 3-Chloro-α-(3-methylphenyl)benzenemethanol represents a significant compound in the realm of synthetic organic chemistry.
Formula:C14H13ClO
InChI:InChI=1S/C14H13ClO/c1-10-4-2-5-11(8-10)14(16)12-6-3-7-13(15)9-12/h2-9,14,16H,1H3
InChI key:InChIKey=CRTRHWCMKYOWPL-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(C)=CC=C1)C2=CC(Cl)=CC=C2
Synonyms:- 3-Chloro-α-(3-methylphenyl)benzenemethanol
- Benzenemethanol, 3-chloro-α-(3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.