CymitQuimica logo

CAS 842140-74-3

:

3,4-Difluoro-α-(3-methylphenyl)benzenemethanol

Description:
3,4-Difluoro-α-(3-methylphenyl)benzenemethanol is an organic compound characterized by its complex structure, which includes a benzene ring substituted with fluorine atoms and a phenyl group with a methyl substituent. The presence of the difluoro groups indicates that the compound has enhanced reactivity and potential for specific interactions due to the electronegative fluorine atoms. This compound likely exhibits properties typical of alcohols, such as the ability to form hydrogen bonds, which can influence its solubility and boiling point. The methyl group on the phenyl ring can also affect the compound's steric and electronic properties, potentially impacting its reactivity and interactions with biological systems. Given its structural features, 3,4-Difluoro-α-(3-methylphenyl)benzenemethanol may be of interest in medicinal chemistry and materials science, where fluorinated compounds often exhibit unique characteristics that can be exploited in various applications. However, specific physical and chemical properties would require empirical data for precise characterization.
Formula:C14H12F2O
InChI:InChI=1S/C14H12F2O/c1-9-3-2-4-10(7-9)14(17)11-5-6-12(15)13(16)8-11/h2-8,14,17H,1H3
InChI key:InChIKey=QZYLHQCVGQXMMC-UHFFFAOYSA-N
SMILES:C(O)(C1=CC(F)=C(F)C=C1)C2=CC(C)=CC=C2
Synonyms:
  • Benzenemethanol, 3,4-difluoro-α-(3-methylphenyl)-
  • 3,4-Difluoro-α-(3-methylphenyl)benzenemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.