CAS 842144-04-1

N-[5-Bromo-2-chloro-4-(ethylamino)-3-pyridinyl]-2-cyanoacetamide

Description:

N-[5-Bromo-2-chloro-4-(ethylamino)-3-pyridinyl]-2-cyanoacetamide is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with bromine and chlorine atoms, as well as an ethylamino group. This compound features a cyanoacetamide functional group, contributing to its potential reactivity and biological activity. The presence of halogen substituents (bromine and chlorine) often enhances the compound's lipophilicity and can influence its pharmacological properties. The ethylamino group may impart basic characteristics, allowing for interactions with biological targets, such as enzymes or receptors. This compound is of interest in medicinal chemistry and may be investigated for its potential therapeutic applications, particularly in the development of pharmaceuticals. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions, including pH and solvent. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity associated with its functional groups.

Formula: C₁₀H₁₀BrClN₄O

InChI: InChI=1S/C10H10BrClN4O/c1-2-14-8-6(11)5-15-10(12)9(8)16-7(17)3-4-13/h5H,2-3H2,1H3,(H,14,15)(H,16,17)

InChI key: InChIKey=VMPXWJFBEVLLSB-UHFFFAOYSA-N

SMILES: N(C(CC#N)=O)C=1C(NCC)=C(Br)C=NC1Cl

Synonyms:

• Acetamide, N-[5-bromo-2-chloro-4-(ethylamino)-3-pyridinyl]-2-cyano-
• N-(5-Bromo-2-chloro-4-ethylaminopyridin-3-yl)-2-cyanoacetamide
• N-[5-Bromo-2-chloro-4-(ethylamino)-3-pyridinyl]-2-cyanoacetamide