CAS 842144-06-3
:(7-Bromo-4-chloro-1-ethyl-1H-imidazo[4,5-c]pyridin-2-yl)hydroxyiminoacetonitrile
Description:
(7-Bromo-4-chloro-1-ethyl-1H-imidazo[4,5-c]pyridin-2-yl)hydroxyiminoacetonitrile is a chemical compound characterized by its complex structure, which includes an imidazo[4,5-c]pyridine core, halogen substituents, and a hydroxyiminoacetonitrile functional group. The presence of bromine and chlorine atoms indicates potential reactivity and influences its physical properties, such as solubility and boiling point. The hydroxyimino group contributes to its potential as a nucleophile, while the acetonitrile moiety may enhance its polarity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its unique structure suggests potential applications in medicinal chemistry, where modifications can lead to varied biological effects. As with many synthetic compounds, safety and handling precautions are essential due to the presence of halogens and the potential for toxicity. Overall, this compound represents a class of heterocyclic compounds that are significant in both academic research and industrial applications.
Formula:C10H7BrClN5O
InChI:InChI=1S/C10H7BrClN5O/c1-2-17-8-5(11)4-14-9(12)7(8)15-10(17)6(3-13)16-18/h4,18H,2H2,1H3
InChI key:InChIKey=MOEJRSVSOANIRC-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(N=C1C(C#N)=NO)=C(Cl)N=CC2Br
Synonyms:- 7-Bromo-4-chloro-1-ethyl-α-(hydroxyimino)-1H-imidazo[4,5-c]pyridine-2-acetonitrile
- 1H-Imidazo[4,5-c]pyridine-2-acetonitrile, 7-bromo-4-chloro-1-ethyl-α-(hydroxyimino)-
- (7-Bromo-4-chloro-1-ethyl-1H-imidazo[4,5-c]pyridin-2-yl)hydroxyiminoacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.