CAS 842144-07-4
:4-(7-Bromo-4-chloro-1-ethyl-1H-imidazo[4,5-c]pyridin-2-yl)-1,2,5-oxadiazol-3-amine
Description:
4-(7-Bromo-4-chloro-1-ethyl-1H-imidazo[4,5-c]pyridin-2-yl)-1,2,5-oxadiazol-3-amine is a chemical compound characterized by its complex structure, which includes an imidazo[4,5-c]pyridine moiety and an oxadiazole ring. This compound features halogen substituents, specifically bromine and chlorine, which can influence its reactivity and biological activity. The presence of the amine group suggests potential for hydrogen bonding and interaction with biological targets, making it of interest in medicinal chemistry. The compound's unique structure may confer specific pharmacological properties, potentially making it a candidate for drug development. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties, such as solubility, stability, and reactivity, would be influenced by the functional groups present. As with many heterocyclic compounds, it may exhibit interesting electronic properties due to the conjugation within its aromatic systems. Further studies would be necessary to fully elucidate its potential applications and mechanisms of action in biological systems.
Formula:C10H8BrClN6O
InChI:InChI=1S/C10H8BrClN6O/c1-2-18-7-4(11)3-14-8(12)5(7)15-10(18)6-9(13)17-19-16-6/h3H,2H2,1H3,(H2,13,17)
InChI key:InChIKey=ZMHOMFQFFLYGJX-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(N=C1C=3C(N)=NON3)=C(Cl)N=CC2Br
Synonyms:- 1,2,5-Oxadiazol-3-amine, 4-(7-bromo-4-chloro-1-ethyl-1H-imidazo[4,5-c]pyridin-2-yl)-
- 4-(7-Bromo-4-chloro-1-ethyl-1H-imidazo[4,5-c]pyridin-2-yl)-1,2,5-oxadiazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(7-Bromo-4-chloro-1-ethyl-1H-imidazo[4,5-c]pyridin-2-yl)-1,2,5-oxadiazol-3-amine
CAS:Formula:C10H8BrClN6OMolecular weight:343.5671
